C26H17F7N6O — CID 19408043
5-(3,4-dimethylphenyl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19408043) has the molecular formula C26H17F7N6O and a molecular weight of 562.45 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19408043 |
| Molecular Formula | C26H17F7N6O |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)n3nc(C(=O)Nc4cnn(Cc5c(F)cc(F)c(F)c5F)c4)cc3n2)cc1C |
| InChI | InChI=1S/C26H17F7N6O/c1-12-3-4-14(5-13(12)2)19-7-21(26(31,32)33)39-22(36-19)8-20(37-39)25(40)35-15-9-34-38(10-15)11-16-17(27)6-18(28)24(30)23(16)29/h3-10H,11H2,1-2H3,(H,35,40) |
| InChIKey | ISKVPFSPCDEWJE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|