C15H17N7O2 — CID 19410760
4-[[2-(benzotriazol-1-yl)acetyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide (PubChem CID 19410760) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 4-[[2-(benzotriazol-1-yl)acetyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide.
| Compound Name | 4-[[2-(benzotriazol-1-yl)acetyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19410760 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4-[[2-(benzotriazol-1-yl)acetyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)Cn2nnc3ccccc32)c(C(=O)NC)n1 |
| InChI | InChI=1S/C15H17N7O2/c1-3-21-8-11(14(19-21)15(24)16-2)17-13(23)9-22-12-7-5-4-6-10(12)18-20-22/h4-8H,3,9H2,1-2H3,(H,16,24)(H,17,23) |
| InChIKey | ZCBDPYGUJVDNKA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |