C23H20ClN3O2 — CID 19411380
N-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 19411380) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 19411380 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc3ccccc3c2)nn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-16-11-22(26-27(16)14-17-5-4-8-20(24)12-17)25-23(28)15-29-21-10-9-18-6-2-3-7-19(18)13-21/h2-13H,14-15H2,1H3,(H,25,26,28) |
| InChIKey | WTGSPPNFNRIZCA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |