C19H20Cl2N6O3 — CID 19411922
N-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19411922) has the molecular formula C19H20Cl2N6O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19411922 |
| Molecular Formula | C19H20Cl2N6O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(C(C)C(=O)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20Cl2N6O3/c1-10-17(27(29)30)9-26(23-10)13(4)19(28)22-18-11(2)24-25(12(18)3)8-14-5-6-15(20)16(21)7-14/h5-7,9,13H,8H2,1-4H3,(H,22,28) |
| InChIKey | UKJLUSAFTBFTNP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|