About 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide
4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19412507) has the molecular formula C19H22N6O2
and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide |
| PubChem CID | 19412507 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cccc(Cn3nc(C)cc3C)c2)c(C(N)=O)n1 |
| InChI | InChI=1S/C19H22N6O2/c1-4-24-11-16(17(23-24)18(20)26)21-19(27)15-7-5-6-14(9-15)10-25-13(3)8-12(2)22-25/h5-9,11H,4,10H2,1-3H3,(H2,20,26)(H,21,27) |
| InChIKey | PORWBKHGJKPIJR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide?
The IUPAC name of 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide (CID 19412507) is 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide.
What is the SMILES notation for 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide?
The canonical SMILES for 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide is CCn1cc(NC(=O)c2cccc(Cn3nc(C)cc3C)c2)c(C(N)=O)n1.
What is the InChIKey of 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide?
The InChIKey is PORWBKHGJKPIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O2/c1-4-24-11-16(17(23-24)18(20)26)21-19(27)15-7-5-6-14(9-15)10-25-13(3)8-12(2)22-25/h5-9,11H,4,10H2,1-3H3,(H2,20,26)(H,21,27).
What are the key properties of 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide?
4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide has a molecular weight of 366.43 g/mol, XLogP of 2.12, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide is sourced from PubChem (CID 19412507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).