C17H22N4O4 — CID 19414239
methyl 1-ethyl-4-[[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-3-carboxylate (PubChem CID 19414239) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 1-ethyl-4-[[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-3-carboxylate.
| Compound Name | methyl 1-ethyl-4-[[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19414239 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 1-ethyl-4-[[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)c2ccc(CN3CCCC3)o2)c(C(=O)OC)n1 |
| InChI | InChI=1S/C17H22N4O4/c1-3-21-11-13(15(19-21)17(23)24-2)18-16(22)14-7-6-12(25-14)10-20-8-4-5-9-20/h6-7,11H,3-5,8-10H2,1-2H3,(H,18,22) |
| InChIKey | HHPXRHQHEMJHSY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |