About N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide
N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19414542) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| PubChem CID | 19414542 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCNC(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C10H12N4O/c1-2-4-12-10(15)8-7-13-14-6-3-5-11-9(8)14/h3,5-7H,2,4H2,1H3,(H,12,15) |
| InChIKey | MUFNCTZCYHDEBS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The IUPAC name of N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide (CID 19414542) is N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
What is the SMILES notation for N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The canonical SMILES for N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide is CCCNC(=O)c1cnn2cccnc12.
What is the InChIKey of N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The InChIKey is MUFNCTZCYHDEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-2-4-12-10(15)8-7-13-14-6-3-5-11-9(8)14/h3,5-7H,2,4H2,1H3,(H,12,15).
What are the key properties of N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide has a molecular weight of 204.23 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylpyrazolo[1,5-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 19414542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).