C13H14N4O3 — CID 19414651
ethyl (E)-3-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)but-2-enoate (PubChem CID 19414651) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl (E)-3-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)but-2-enoate.
| Compound Name | ethyl (E)-3-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)but-2-enoate |
|---|---|
| PubChem CID | 19414651 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl (E)-3-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C13H14N4O3/c1-3-20-11(18)7-9(2)16-13(19)10-8-15-17-6-4-5-14-12(10)17/h4-8H,3H2,1-2H3,(H,16,19)/b9-7+ |
| InChIKey | UTAGHRLOUCRXBM-VQHVLOKHSA-N |
| XLogP | 0.93 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|