C17H19ClN6O2 — CID 19414820
4-[[7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]butanoyl chloride (PubChem CID 19414820) has the molecular formula C17H19ClN6O2 and a molecular weight of 374.83 g/mol. Its IUPAC name is 4-[[7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]butanoyl chloride.
| Compound Name | 4-[[7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19414820 |
| Molecular Formula | C17H19ClN6O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[[7-(1-ethyl-3-methylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]butanoyl chloride |
| SMILES | CCn1cc(-c2ccnc3c(C(=O)NCCCC(=O)Cl)cnn23)c(C)n1 |
| InChI | InChI=1S/C17H19ClN6O2/c1-3-23-10-13(11(2)22-23)14-6-8-19-16-12(9-21-24(14)16)17(26)20-7-4-5-15(18)25/h6,8-10H,3-5,7H2,1-2H3,(H,20,26) |
| InChIKey | WLLUXIQFCHFZJL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|