About [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol
[4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol (PubChem CID 19417349) has the molecular formula C16H17Cl2NO4S
and a molecular weight of 390.29 g/mol. Its IUPAC name is [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol.
Molecular Properties
| Compound Name | [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol |
| PubChem CID | 19417349 |
| Molecular Formula | C16H17Cl2NO4S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol |
| SMILES | CCOc1c(S(=O)(=O)CO)ccc(Cc2c(Cl)ccnc2Cl)c1C |
| InChI | InChI=1S/C16H17Cl2NO4S/c1-3-23-15-10(2)11(4-5-14(15)24(21,22)9-20)8-12-13(17)6-7-19-16(12)18/h4-7,20H,3,8-9H2,1-2H3 |
| InChIKey | GYAALARTUXSVDE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol?
The IUPAC name of [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol (CID 19417349) is [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol.
What is the SMILES notation for [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol?
The canonical SMILES for [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol is CCOc1c(S(=O)(=O)CO)ccc(Cc2c(Cl)ccnc2Cl)c1C.
What is the InChIKey of [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol?
The InChIKey is GYAALARTUXSVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2NO4S/c1-3-23-15-10(2)11(4-5-14(15)24(21,22)9-20)8-12-13(17)6-7-19-16(12)18/h4-7,20H,3,8-9H2,1-2H3.
What are the key properties of [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol?
[4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol has a molecular weight of 390.29 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-dichloro-3-pyridinyl)methyl]-2-ethoxy-3-methylphenyl]sulfonylmethanol is sourced from PubChem (CID 19417349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).