C21H24F3N5O6 — CID 19417491
3-[7-[4-(diaminomethylideneamino)-3-methylbut-1-ynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 19417491) has the molecular formula C21H24F3N5O6 and a molecular weight of 499.45 g/mol. Its IUPAC name is 3-[7-[4-(diaminomethylideneamino)-3-methylbut-1-ynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[4-(diaminomethylideneamino)-3-methylbut-1-ynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 19417491 |
| Molecular Formula | C21H24F3N5O6 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 3-[7-[4-(diaminomethylideneamino)-3-methylbut-1-ynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C#Cc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2C)CN=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N5O4.C2HF3O2/c1-12(10-22-19(20)21)3-4-13-5-6-15-14(9-13)18(28)24(8-7-17(26)27)11-16(25)23(15)2;3-2(4,5)1(6)7/h5-6,9,12H,7-8,10-11H2,1-2H3,(H,26,27)(H4,20,21,22);(H,6,7) |
| InChIKey | CXRDZSMETKWRCV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|