About 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole
3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole (PubChem CID 19417610) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole.
Molecular Properties
| Compound Name | 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole |
| PubChem CID | 19417610 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole |
| SMILES | c1nc2c(n1C1CCCCC1)CCC2 |
| InChI | InChI=1S/C12H18N2/c1-2-5-10(6-3-1)14-9-13-11-7-4-8-12(11)14/h9-10H,1-8H2 |
| InChIKey | PCJVANWVMHRSJW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The IUPAC name of 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole (CID 19417610) is 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole.
What is the SMILES notation for 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The canonical SMILES for 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole is c1nc2c(n1C1CCCCC1)CCC2.
What is the InChIKey of 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The InChIKey is PCJVANWVMHRSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-2-5-10(6-3-1)14-9-13-11-7-4-8-12(11)14/h9-10H,1-8H2.
What are the key properties of 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole has a molecular weight of 190.29 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]imidazole is sourced from PubChem (CID 19417610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).