C9HF17O4 — CID 19417873
2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propan-2-yl]oxypropanoic acid (PubChem CID 19417873) has the molecular formula C9HF17O4 and a molecular weight of 496.07 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propan-2-yl]oxypropanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 19417873 |
| Molecular Formula | C9HF17O4 |
| Molecular Weight | 496.07 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propan-2-yl]oxypropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9HF17O4/c10-2(11,1(27)28)8(23,24)30-4(13,7(20,21)22)9(25,26)29-3(12,5(14,15)16)6(17,18)19/h(H,27,28) |
| InChIKey | HXYITXQAHYKRRS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|