C53H63O12P3 — CID 19417903
[2-[bis(2,6-dimethoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(2,6-dimethoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane (PubChem CID 19417903) has the molecular formula C53H63O12P3 and a molecular weight of 985.00 g/mol. Its IUPAC name is [2-[bis(2,6-dimethoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(2,6-dimethoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane.
| Compound Name | [2-[bis(2,6-dimethoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(2,6-dimethoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane |
|---|---|
| PubChem CID | 19417903 |
| Molecular Formula | C53H63O12P3 |
| Molecular Weight | 985.00 g/mol |
| Exact Mass | 984.35 |
| IUPAC Name | [2-[bis(2,6-dimethoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(2,6-dimethoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane |
| SMILES | COc1cccc(OC)c1C(P)(c1c(OC)cccc1OC)C(C)(C(P)(c1c(OC)cccc1OC)c1c(OC)cccc1OC)C(P)(c1c(OC)cccc1OC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C53H63O12P3/c1-50(51(66,44-32(54-2)20-14-21-33(44)55-3)45-34(56-4)22-15-23-35(45)57-5,52(67,46-36(58-6)24-16-25-37(46)59-7)47-38(60-8)26-17-27-39(47)61-9)53(68,48-40(62-10)28-18-29-41(48)63-11)49-42(64-12)30-19-31-43(49)65-13/h14-31H,66-68H2,1-13H3 |
| InChIKey | HYTKZEZSJYZBKT-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.00 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|