About 1-octylsulfanylethyl hydrogen carbonate
1-octylsulfanylethyl hydrogen carbonate (PubChem CID 19418291) has the molecular formula C11H22O3S
and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-octylsulfanylethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 1-octylsulfanylethyl hydrogen carbonate |
| PubChem CID | 19418291 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-octylsulfanylethyl hydrogen carbonate |
| SMILES | CCCCCCCCSC(C)OC(=O)O |
| InChI | InChI=1S/C11H22O3S/c1-3-4-5-6-7-8-9-15-10(2)14-11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | FCINEHLNSAECMX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-octylsulfanylethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylsulfanylethyl hydrogen carbonate?
The IUPAC name of 1-octylsulfanylethyl hydrogen carbonate (CID 19418291) is 1-octylsulfanylethyl hydrogen carbonate.
What is the SMILES notation for 1-octylsulfanylethyl hydrogen carbonate?
The canonical SMILES for 1-octylsulfanylethyl hydrogen carbonate is CCCCCCCCSC(C)OC(=O)O.
What is the InChIKey of 1-octylsulfanylethyl hydrogen carbonate?
The InChIKey is FCINEHLNSAECMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3S/c1-3-4-5-6-7-8-9-15-10(2)14-11(12)13/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 1-octylsulfanylethyl hydrogen carbonate?
1-octylsulfanylethyl hydrogen carbonate has a molecular weight of 234.36 g/mol, XLogP of 4.12, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylsulfanylethyl hydrogen carbonate is sourced from PubChem (CID 19418291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).