About (E)-but-2-enenitrile;2-methylprop-2-enenitrile
(E)-but-2-enenitrile;2-methylprop-2-enenitrile (PubChem CID 19418407) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (E)-but-2-enenitrile;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-but-2-enenitrile;2-methylprop-2-enenitrile |
| PubChem CID | 19418407 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (E)-but-2-enenitrile;2-methylprop-2-enenitrile |
| SMILES | C/C=C/C#N.C=C(C)C#N |
| InChI | InChI=1S/2C4H5N/c1-4(2)3-5;1-2-3-4-5/h1H2,2H3;2-3H,1H3/b;3-2+ |
| InChIKey | WQNGAEUXAGTMER-ZPYUXNTASA-N |
| XLogP | 2.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enenitrile;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enenitrile;2-methylprop-2-enenitrile?
The IUPAC name of (E)-but-2-enenitrile;2-methylprop-2-enenitrile (CID 19418407) is (E)-but-2-enenitrile;2-methylprop-2-enenitrile.
What is the SMILES notation for (E)-but-2-enenitrile;2-methylprop-2-enenitrile?
The canonical SMILES for (E)-but-2-enenitrile;2-methylprop-2-enenitrile is C/C=C/C#N.C=C(C)C#N.
What is the InChIKey of (E)-but-2-enenitrile;2-methylprop-2-enenitrile?
The InChIKey is WQNGAEUXAGTMER-ZPYUXNTASA-N. The full InChI is InChI=1S/2C4H5N/c1-4(2)3-5;1-2-3-4-5/h1H2,2H3;2-3H,1H3/b;3-2+.
What are the key properties of (E)-but-2-enenitrile;2-methylprop-2-enenitrile?
(E)-but-2-enenitrile;2-methylprop-2-enenitrile has a molecular weight of 134.18 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enenitrile;2-methylprop-2-enenitrile is sourced from PubChem (CID 19418407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).