C12H13ClN2 — CID 19418954
8-chloro-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 19418954) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 8-chloro-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 8-chloro-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 19418954 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 8-chloro-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Cc1cc(Cl)c2[nH]c3c(c2c1)CCNC3 |
| InChI | InChI=1S/C12H13ClN2/c1-7-4-9-8-2-3-14-6-11(8)15-12(9)10(13)5-7/h4-5,14-15H,2-3,6H2,1H3 |
| InChIKey | MEMVNJLFSBZXFX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|