C9H12F8N2O2 — CID 19419159
N-(7-amino-1,1,1,2,2-pentafluoro-3-hydroxyheptan-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 19419159) has the molecular formula C9H12F8N2O2 and a molecular weight of 332.19 g/mol. Its IUPAC name is N-(7-amino-1,1,1,2,2-pentafluoro-3-hydroxyheptan-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(7-amino-1,1,1,2,2-pentafluoro-3-hydroxyheptan-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 19419159 |
| Molecular Formula | C9H12F8N2O2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(7-amino-1,1,1,2,2-pentafluoro-3-hydroxyheptan-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | NCCCC(NC(=O)C(F)(F)F)C(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F8N2O2/c10-7(11,9(15,16)17)5(20)4(2-1-3-18)19-6(21)8(12,13)14/h4-5,20H,1-3,18H2,(H,19,21) |
| InChIKey | YECFHNFCKARUEN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|