About 2-(diethylamino)-4,5-dimethylphenol
2-(diethylamino)-4,5-dimethylphenol (PubChem CID 19419378) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(diethylamino)-4,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-(diethylamino)-4,5-dimethylphenol |
| PubChem CID | 19419378 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(diethylamino)-4,5-dimethylphenol |
| SMILES | CCN(CC)c1cc(C)c(C)cc1O |
| InChI | InChI=1S/C12H19NO/c1-5-13(6-2)11-7-9(3)10(4)8-12(11)14/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | ABCBFHPKGKJBOE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)-4,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-4,5-dimethylphenol?
The IUPAC name of 2-(diethylamino)-4,5-dimethylphenol (CID 19419378) is 2-(diethylamino)-4,5-dimethylphenol.
What is the SMILES notation for 2-(diethylamino)-4,5-dimethylphenol?
The canonical SMILES for 2-(diethylamino)-4,5-dimethylphenol is CCN(CC)c1cc(C)c(C)cc1O.
What is the InChIKey of 2-(diethylamino)-4,5-dimethylphenol?
The InChIKey is ABCBFHPKGKJBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-13(6-2)11-7-9(3)10(4)8-12(11)14/h7-8,14H,5-6H2,1-4H3.
What are the key properties of 2-(diethylamino)-4,5-dimethylphenol?
2-(diethylamino)-4,5-dimethylphenol has a molecular weight of 193.29 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-4,5-dimethylphenol is sourced from PubChem (CID 19419378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).