C22H27N5O4 — CID 19419458
methyl 4-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]-methylamino]cyclohexane-1-carboxylate (PubChem CID 19419458) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 4-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]-methylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]-methylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19419458 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | methyl 4-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]-methylamino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C(=O)N(C)C3CCC(C(=O)OC)CC3)c(=O)n(C)n2)cc1 |
| InChI | InChI=1S/C22H27N5O4/c1-26(16-10-8-15(9-11-16)22(30)31-3)20(28)17-12-18(25-27(2)21(17)29)13-4-6-14(7-5-13)19(23)24/h4-7,12,15-16H,8-11H2,1-3H3,(H3,23,24) |
| InChIKey | PZYOJVGLBJOOLU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|