C25H26N6O5 — CID 19419811
methyl 2-[benzoyl-[2-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]ethyl]amino]acetate (PubChem CID 19419811) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is methyl 2-[benzoyl-[2-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]ethyl]amino]acetate.
| Compound Name | methyl 2-[benzoyl-[2-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 19419811 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | methyl 2-[benzoyl-[2-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]ethyl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C(=O)NCCN(CC(=O)OC)C(=O)c3ccccc3)c(=O)n(C)n2)cc1 |
| InChI | InChI=1S/C25H26N6O5/c1-30-25(35)19(14-20(29-30)16-8-10-17(11-9-16)22(26)27)23(33)28-12-13-31(15-21(32)36-2)24(34)18-6-4-3-5-7-18/h3-11,14H,12-13,15H2,1-2H3,(H3,26,27)(H,28,33) |
| InChIKey | HNLYZSWJDUMDDM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 160.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|