About 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate
2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate (PubChem CID 19419934) has the molecular formula C13H23N2O6S+
and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate |
| PubChem CID | 19419934 |
| Molecular Formula | C13H23N2O6S+ |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].O=S(=O)(O)CC(O)C[n+]1ccccc1 |
| InChI | InChI=1S/C8H11NO4S.C5H11NO2/c10-8(7-14(11,12)13)6-9-4-2-1-3-5-9;1-6(2,3)4-5(7)8/h1-5,8,10H,6-7H2;4H2,1-3H3/p+1 |
| InChIKey | KRERSNGVUXSJJO-UHFFFAOYSA-O |
| XLogP | -2.33 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate?
The IUPAC name of 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate (CID 19419934) is 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate?
The canonical SMILES for 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate is C[N+](C)(C)CC(=O)[O-].O=S(=O)(O)CC(O)C[n+]1ccccc1.
What is the InChIKey of 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate?
The InChIKey is KRERSNGVUXSJJO-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H11NO4S.C5H11NO2/c10-8(7-14(11,12)13)6-9-4-2-1-3-5-9;1-6(2,3)4-5(7)8/h1-5,8,10H,6-7H2;4H2,1-3H3/p+1.
What are the key properties of 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate?
2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate has a molecular weight of 335.40 g/mol, XLogP of -2.33, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 19419934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).