About 10-methylundecyl hydrogen carbonate
10-methylundecyl hydrogen carbonate (PubChem CID 19420109) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 10-methylundecyl hydrogen carbonate.
Molecular Properties
| Compound Name | 10-methylundecyl hydrogen carbonate |
| PubChem CID | 19420109 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 10-methylundecyl hydrogen carbonate |
| SMILES | CC(C)CCCCCCCCCOC(=O)O |
| InChI | InChI=1S/C13H26O3/c1-12(2)10-8-6-4-3-5-7-9-11-16-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | QEQGZMQIJJHKKE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-methylundecyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylundecyl hydrogen carbonate?
The IUPAC name of 10-methylundecyl hydrogen carbonate (CID 19420109) is 10-methylundecyl hydrogen carbonate.
What is the SMILES notation for 10-methylundecyl hydrogen carbonate?
The canonical SMILES for 10-methylundecyl hydrogen carbonate is CC(C)CCCCCCCCCOC(=O)O.
What is the InChIKey of 10-methylundecyl hydrogen carbonate?
The InChIKey is QEQGZMQIJJHKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-12(2)10-8-6-4-3-5-7-9-11-16-13(14)15/h12H,3-11H2,1-2H3,(H,14,15).
What are the key properties of 10-methylundecyl hydrogen carbonate?
10-methylundecyl hydrogen carbonate has a molecular weight of 230.35 g/mol, XLogP of 4.46, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylundecyl hydrogen carbonate is sourced from PubChem (CID 19420109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).