C32H33F6NO3 — CID 19420344
tert-butyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylhex-5-en-2-yl]carbamate (PubChem CID 19420344) has the molecular formula C32H33F6NO3 and a molecular weight of 593.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 19420344 |
| Molecular Formula | C32H33F6NO3 |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | tert-butyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylhex-5-en-2-yl]carbamate |
| SMILES | C=CCC(OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(NC(=O)OC(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33F6NO3/c1-5-12-26(41-20-21-17-24(31(33,34)35)19-25(18-21)32(36,37)38)28(39-29(40)42-30(2,3)4)27(22-13-8-6-9-14-22)23-15-10-7-11-16-23/h5-11,13-19,26-28H,1,12,20H2,2-4H3,(H,39,40) |
| InChIKey | VIQHEZNAKVVXLE-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|