C11H15NO2 — CID 19420482
3,4-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 19420482) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3,4-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3,4-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 19420482 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3,4-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COC1NCc2ccccc2C1OC |
| InChI | InChI=1S/C11H15NO2/c1-13-10-9-6-4-3-5-8(9)7-12-11(10)14-2/h3-6,10-12H,7H2,1-2H3 |
| InChIKey | QKTLSLSBVUIJLV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |