About cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride
cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride (PubChem CID 19421136) has the molecular formula C6H14Cl4N2
and a molecular weight of 256.00 g/mol. Its IUPAC name is cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride.
Molecular Properties
| Compound Name | cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride |
| PubChem CID | 19421136 |
| Molecular Formula | C6H14Cl4N2 |
| Molecular Weight | 256.00 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C6H10N2.4ClH/c7-6(8)4-2-1-3-5-6;;;;/h1-4H,5,7-8H2;4*1H |
| InChIKey | PAGWZLPHIVHUNV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.00 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride?
The IUPAC name of cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride (CID 19421136) is cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride.
What is the SMILES notation for cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride?
The canonical SMILES for cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride is Cl.Cl.Cl.Cl.NC1(N)C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride?
The InChIKey is PAGWZLPHIVHUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.4ClH/c7-6(8)4-2-1-3-5-6;;;;/h1-4H,5,7-8H2;4*1H.
What are the key properties of cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride?
cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride has a molecular weight of 256.00 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-diene-1,1-diamine;tetrahydrochloride is sourced from PubChem (CID 19421136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).