C12H9F9O9S3 — CID 19421199
[3,4-bis(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate (PubChem CID 19421199) has the molecular formula C12H9F9O9S3 and a molecular weight of 564.38 g/mol. Its IUPAC name is [3,4-bis(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [3,4-bis(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 19421199 |
| Molecular Formula | C12H9F9O9S3 |
| Molecular Weight | 564.38 g/mol |
| Exact Mass | 563.93 |
| IUPAC Name | [3,4-bis(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)Oc1ccc(OS(=O)(=O)CC(F)(F)F)c(OS(=O)(=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F9O9S3/c13-10(14,15)4-31(22,23)28-7-1-2-8(29-32(24,25)5-11(16,17)18)9(3-7)30-33(26,27)6-12(19,20)21/h1-3H,4-6H2 |
| InChIKey | WSPZJXZZEJNSDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|