C18H19N4O4P — CID 19421406
12-(diethoxyphosphorylmethyl)-11,13,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaen-16-one (PubChem CID 19421406) has the molecular formula C18H19N4O4P and a molecular weight of 386.35 g/mol. Its IUPAC name is 12-(diethoxyphosphorylmethyl)-11,13,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaen-16-one.
| Compound Name | 12-(diethoxyphosphorylmethyl)-11,13,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaen-16-one |
|---|---|
| PubChem CID | 19421406 |
| Molecular Formula | C18H19N4O4P |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 12-(diethoxyphosphorylmethyl)-11,13,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaen-16-one |
| SMILES | CCOP(=O)(Cc1nnc2c(=O)[nH]c3c4ccccc4ccc3n12)OCC |
| InChI | InChI=1S/C18H19N4O4P/c1-3-25-27(24,26-4-2)11-15-20-21-17-18(23)19-16-13-8-6-5-7-12(13)9-10-14(16)22(15)17/h5-10H,3-4,11H2,1-2H3,(H,19,23) |
| InChIKey | AKWLSQRZBIOAGM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|