C11H7F3N5O6P — CID 19421419
[8-nitro-4-oxo-7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl]methylphosphonic acid (PubChem CID 19421419) has the molecular formula C11H7F3N5O6P and a molecular weight of 393.17 g/mol. Its IUPAC name is [8-nitro-4-oxo-7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl]methylphosphonic acid.
| Compound Name | [8-nitro-4-oxo-7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 19421419 |
| Molecular Formula | C11H7F3N5O6P |
| Molecular Weight | 393.17 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | [8-nitro-4-oxo-7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl]methylphosphonic acid |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)c([N+](=O)[O-])cc2n2c(CP(=O)(O)O)nnc12 |
| InChI | InChI=1S/C11H7F3N5O6P/c12-11(13,14)4-1-5-7(2-6(4)19(21)22)18-8(3-26(23,24)25)16-17-9(18)10(20)15-5/h1-2H,3H2,(H,15,20)(H2,23,24,25) |
| InChIKey | HWKBXSGVLUFORX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|