C31H34FN3O2 — CID 19421995
4-[1-(3-benzylimidazol-4-yl)-4-(4-fluorophenyl)-1-hydroxybutyl]-N-tert-butylbenzamide (PubChem CID 19421995) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is 4-[1-(3-benzylimidazol-4-yl)-4-(4-fluorophenyl)-1-hydroxybutyl]-N-tert-butylbenzamide.
| Compound Name | 4-[1-(3-benzylimidazol-4-yl)-4-(4-fluorophenyl)-1-hydroxybutyl]-N-tert-butylbenzamide |
|---|---|
| PubChem CID | 19421995 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 4-[1-(3-benzylimidazol-4-yl)-4-(4-fluorophenyl)-1-hydroxybutyl]-N-tert-butylbenzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(C(O)(CCCc2ccc(F)cc2)c2cncn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34FN3O2/c1-30(2,3)34-29(36)25-13-15-26(16-14-25)31(37,19-7-10-23-11-17-27(32)18-12-23)28-20-33-22-35(28)21-24-8-5-4-6-9-24/h4-6,8-9,11-18,20,22,37H,7,10,19,21H2,1-3H3,(H,34,36) |
| InChIKey | YNROJSQZXHMZHN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |