C6H9N3 — CID 19422863
5,6-dimethylpyridazin-3-amine (PubChem CID 19422863) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 5,6-dimethylpyridazin-3-amine.
| Compound Name | 5,6-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 19422863 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5,6-dimethylpyridazin-3-amine |
| SMILES | Cc1cc(N)nnc1C |
| InChI | InChI=1S/C6H9N3/c1-4-3-6(7)9-8-5(4)2/h3H,1-2H3,(H2,7,9) |
| InChIKey | FWUNCMRZTFCAAD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |