C10H16N3O2+ — CID 19423348
3,6,6-trimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-ium-2,4-dione (PubChem CID 19423348) has the molecular formula C10H16N3O2+ and a molecular weight of 210.26 g/mol. Its IUPAC name is 3,6,6-trimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 3,6,6-trimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 19423348 |
| Molecular Formula | C10H16N3O2+ |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3,6,6-trimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-ium-2,4-dione |
| SMILES | Cn1c(=O)[nH]c2c(c1=O)C[N+](C)(C)CC2 |
| InChI | InChI=1S/C10H15N3O2/c1-12-9(14)7-6-13(2,3)5-4-8(7)11-10(12)15/h4-6H2,1-3H3/p+1 |
| InChIKey | RLTLYEZFFRNVCZ-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|