C18H29N3O4 — CID 19423358
tert-butyl 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoate (PubChem CID 19423358) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoate.
| Compound Name | tert-butyl 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoate |
|---|---|
| PubChem CID | 19423358 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoate |
| SMILES | Cn1c(=O)[nH]c2c(c1=O)CN(CCCCCC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H29N3O4/c1-18(2,3)25-15(22)8-6-5-7-10-21-11-9-14-13(12-21)16(23)20(4)17(24)19-14/h5-12H2,1-4H3,(H,19,24) |
| InChIKey | SWYGEMOTKWBXFT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|