C9H14IN3O2 — CID 19423359
3,6-dimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione;hydroiodide (PubChem CID 19423359) has the molecular formula C9H14IN3O2 and a molecular weight of 323.13 g/mol. Its IUPAC name is 3,6-dimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione;hydroiodide.
| Compound Name | 3,6-dimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione;hydroiodide |
|---|---|
| PubChem CID | 19423359 |
| Molecular Formula | C9H14IN3O2 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3,6-dimethyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione;hydroiodide |
| SMILES | CN1CCc2[nH]c(=O)n(C)c(=O)c2C1.I |
| InChI | InChI=1S/C9H13N3O2.HI/c1-11-4-3-7-6(5-11)8(13)12(2)9(14)10-7;/h3-5H2,1-2H3,(H,10,14);1H |
| InChIKey | FWWGTXLKEJZLDO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|