About [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol
[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol (PubChem CID 19424089) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| PubChem CID | 19424089 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| SMILES | OCC1COC(c2ccccc2F)=N1 |
| InChI | InChI=1S/C10H10FNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,7,13H,5-6H2 |
| InChIKey | HXXSTLBCZNLTTF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol?
The IUPAC name of [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol (CID 19424089) is [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol.
What is the SMILES notation for [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol?
The canonical SMILES for [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol is OCC1COC(c2ccccc2F)=N1.
What is the InChIKey of [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol?
The InChIKey is HXXSTLBCZNLTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,7,13H,5-6H2.
What are the key properties of [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol?
[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol has a molecular weight of 195.19 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol is sourced from PubChem (CID 19424089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).