C21H23F2NO3 — CID 19424116
2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2-methylphenoxy]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 19424116) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2-methylphenoxy]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2-methylphenoxy]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19424116 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2-methylphenoxy]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CCOCCc1ccc(OCC2COC(c3c(F)cccc3F)=N2)c(C)c1 |
| InChI | InChI=1S/C21H23F2NO3/c1-3-25-10-9-15-7-8-19(14(2)11-15)26-12-16-13-27-21(24-16)20-17(22)5-4-6-18(20)23/h4-8,11,16H,3,9-10,12-13H2,1-2H3 |
| InChIKey | BFDKDYGTSWVEJW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|