C21H38O10 — CID 19424385
2-hydroxy-2-[2-oxo-2-(1,1,2-tributoxypropan-2-yloxy)ethyl]butanedioic acid (PubChem CID 19424385) has the molecular formula C21H38O10 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(1,1,2-tributoxypropan-2-yloxy)ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(1,1,2-tributoxypropan-2-yloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 19424385 |
| Molecular Formula | C21H38O10 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(1,1,2-tributoxypropan-2-yloxy)ethyl]butanedioic acid |
| SMILES | CCCCOC(OCCCC)C(C)(OCCCC)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H38O10/c1-5-8-11-28-19(29-12-9-6-2)20(4,30-13-10-7-3)31-17(24)15-21(27,18(25)26)14-16(22)23/h19,27H,5-15H2,1-4H3,(H,22,23)(H,25,26) |
| InChIKey | DMUGGJSJNLCAGF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|