C18H32O10 — CID 19424391
2-hydroxy-2-[2-oxo-2-(1,1,2-tripropoxypropan-2-yloxy)ethyl]butanedioic acid (PubChem CID 19424391) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(1,1,2-tripropoxypropan-2-yloxy)ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(1,1,2-tripropoxypropan-2-yloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 19424391 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(1,1,2-tripropoxypropan-2-yloxy)ethyl]butanedioic acid |
| SMILES | CCCOC(OCCC)C(C)(OCCC)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H32O10/c1-5-8-25-16(26-9-6-2)17(4,27-10-7-3)28-14(21)12-18(24,15(22)23)11-13(19)20/h16,24H,5-12H2,1-4H3,(H,19,20)(H,22,23) |
| InChIKey | TXJIJOJFTDZPBV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|