C7H12N2 — CID 19424595
1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrimidine (PubChem CID 19424595) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrimidine.
| Compound Name | 1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 19424595 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrimidine |
| SMILES | C1=CNC2CCCN2C1 |
| InChI | InChI=1S/C7H12N2/c1-3-7-8-4-2-6-9(7)5-1/h2,4,7-8H,1,3,5-6H2 |
| InChIKey | CVZHCNMWRJAHOQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |