About 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide
1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide (PubChem CID 19424676) has the molecular formula C8H10BrNO2
and a molecular weight of 232.08 g/mol. Its IUPAC name is 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide.
Molecular Properties
| Compound Name | 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide |
| PubChem CID | 19424676 |
| Molecular Formula | C8H10BrNO2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide |
| SMILES | Br.OC1Cc2ccccc2N1O |
| InChI | InChI=1S/C8H9NO2.BrH/c10-8-5-6-3-1-2-4-7(6)9(8)11;/h1-4,8,10-11H,5H2;1H |
| InChIKey | LMEIOUOMYCTXMH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide?
The IUPAC name of 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide (CID 19424676) is 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide.
What is the SMILES notation for 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide?
The canonical SMILES for 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide is Br.OC1Cc2ccccc2N1O.
What is the InChIKey of 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide?
The InChIKey is LMEIOUOMYCTXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.BrH/c10-8-5-6-3-1-2-4-7(6)9(8)11;/h1-4,8,10-11H,5H2;1H.
What are the key properties of 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide?
1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide has a molecular weight of 232.08 g/mol, XLogP of 1.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,3-dihydroindol-2-ol;hydrobromide is sourced from PubChem (CID 19424676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).