C5Cl2F10 — CID 19424806
1,2-dichloro-1,1,2,3,3,4,4,5,5,5-decafluoropentane (PubChem CID 19424806) has the molecular formula C5Cl2F10 and a molecular weight of 320.94 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2,3,3,4,4,5,5,5-decafluoropentane.
| Compound Name | 1,2-dichloro-1,1,2,3,3,4,4,5,5,5-decafluoropentane |
|---|---|
| PubChem CID | 19424806 |
| Molecular Formula | C5Cl2F10 |
| Molecular Weight | 320.94 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 1,2-dichloro-1,1,2,3,3,4,4,5,5,5-decafluoropentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5Cl2F10/c6-1(8,4(7,13)14)2(9,10)3(11,12)5(15,16)17 |
| InChIKey | WPVIZJVPOXQLTM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.94 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|