C26H28O — CID 19424967
1-ethoxy-4-[(E)-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 19424967) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-ethoxy-4-[(E)-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1-ethoxy-4-[(E)-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 19424967 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-ethoxy-4-[(E)-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | CCCCCCc1ccc(C#C/C=C/C#Cc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C26H28O/c1-3-5-6-9-12-23-15-17-24(18-16-23)13-10-7-8-11-14-25-19-21-26(22-20-25)27-4-2/h7-8,15-22H,3-6,9,12H2,1-2H3/b8-7+ |
| InChIKey | ALKOIYDYHQORIP-BQYQJAHWSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|