About methylamino 2-methylprop-2-enoate;pyrrolidin-2-one
methylamino 2-methylprop-2-enoate;pyrrolidin-2-one (PubChem CID 19425053) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is methylamino 2-methylprop-2-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | methylamino 2-methylprop-2-enoate;pyrrolidin-2-one |
| PubChem CID | 19425053 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | methylamino 2-methylprop-2-enoate;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)ONC.O=C1CCCN1 |
| InChI | InChI=1S/C5H9NO2.C4H7NO/c1-4(2)5(7)8-6-3;6-4-2-1-3-5-4/h6H,1H2,2-3H3;1-3H2,(H,5,6) |
| InChIKey | DDGGBSRNSXLMLU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino 2-methylprop-2-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino 2-methylprop-2-enoate;pyrrolidin-2-one?
The IUPAC name of methylamino 2-methylprop-2-enoate;pyrrolidin-2-one (CID 19425053) is methylamino 2-methylprop-2-enoate;pyrrolidin-2-one.
What is the SMILES notation for methylamino 2-methylprop-2-enoate;pyrrolidin-2-one?
The canonical SMILES for methylamino 2-methylprop-2-enoate;pyrrolidin-2-one is C=C(C)C(=O)ONC.O=C1CCCN1.
What is the InChIKey of methylamino 2-methylprop-2-enoate;pyrrolidin-2-one?
The InChIKey is DDGGBSRNSXLMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C4H7NO/c1-4(2)5(7)8-6-3;6-4-2-1-3-5-4/h6H,1H2,2-3H3;1-3H2,(H,5,6).
What are the key properties of methylamino 2-methylprop-2-enoate;pyrrolidin-2-one?
methylamino 2-methylprop-2-enoate;pyrrolidin-2-one has a molecular weight of 200.24 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino 2-methylprop-2-enoate;pyrrolidin-2-one is sourced from PubChem (CID 19425053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).