About 2,2-diethylmorpholine
2,2-diethylmorpholine (PubChem CID 19425063) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2,2-diethylmorpholine.
Molecular Properties
| Compound Name | 2,2-diethylmorpholine |
| PubChem CID | 19425063 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2,2-diethylmorpholine |
| SMILES | CCC1(CC)CNCCO1 |
| InChI | InChI=1S/C8H17NO/c1-3-8(4-2)7-9-5-6-10-8/h9H,3-7H2,1-2H3 |
| InChIKey | LASBQIGGDYZBRE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethylmorpholine?
The IUPAC name of 2,2-diethylmorpholine (CID 19425063) is 2,2-diethylmorpholine.
What is the SMILES notation for 2,2-diethylmorpholine?
The canonical SMILES for 2,2-diethylmorpholine is CCC1(CC)CNCCO1.
What is the InChIKey of 2,2-diethylmorpholine?
The InChIKey is LASBQIGGDYZBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-8(4-2)7-9-5-6-10-8/h9H,3-7H2,1-2H3.
What are the key properties of 2,2-diethylmorpholine?
2,2-diethylmorpholine has a molecular weight of 143.23 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethylmorpholine is sourced from PubChem (CID 19425063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).