About 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid
4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid (PubChem CID 19425178) has the molecular formula C7H8ClNO3S
and a molecular weight of 221.66 g/mol. Its IUPAC name is 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid |
| PubChem CID | 19425178 |
| Molecular Formula | C7H8ClNO3S |
| Molecular Weight | 221.66 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCn1sc(Cl)cc1=O |
| InChI | InChI=1S/C7H8ClNO3S/c8-5-4-6(10)9(13-5)3-1-2-7(11)12/h4H,1-3H2,(H,11,12) |
| InChIKey | JNWGRCYCKMOLQW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid?
The IUPAC name of 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid (CID 19425178) is 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid?
The canonical SMILES for 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid is O=C(O)CCCn1sc(Cl)cc1=O.
What is the InChIKey of 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid?
The InChIKey is JNWGRCYCKMOLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO3S/c8-5-4-6(10)9(13-5)3-1-2-7(11)12/h4H,1-3H2,(H,11,12).
What are the key properties of 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid?
4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid has a molecular weight of 221.66 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-3-oxo-1,2-thiazol-2-yl)butanoic acid is sourced from PubChem (CID 19425178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).