C20H21BrFNO3 — CID 19425262
2-[4-bromo-2-fluoro-5-(2-methylcyclopentyl)oxyphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 19425262) has the molecular formula C20H21BrFNO3 and a molecular weight of 422.29 g/mol. Its IUPAC name is 2-[4-bromo-2-fluoro-5-(2-methylcyclopentyl)oxyphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-bromo-2-fluoro-5-(2-methylcyclopentyl)oxyphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 19425262 |
| Molecular Formula | C20H21BrFNO3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[4-bromo-2-fluoro-5-(2-methylcyclopentyl)oxyphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC1CCCC1Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Br |
| InChI | InChI=1S/C20H21BrFNO3/c1-11-5-4-8-17(11)26-18-10-16(15(22)9-14(18)21)23-19(24)12-6-2-3-7-13(12)20(23)25/h9-11,17H,2-8H2,1H3 |
| InChIKey | MXOLFAWDHCPVRT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|