About 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole
7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole (PubChem CID 19425983) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole.
Molecular Properties
| Compound Name | 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole |
| PubChem CID | 19425983 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole |
| SMILES | CN1Cc2ccc3c(c2C1)=NCN=3 |
| InChI | InChI=1S/C10H11N3/c1-13-4-7-2-3-9-10(8(7)5-13)12-6-11-9/h2-3H,4-6H2,1H3 |
| InChIKey | VVFCTHLDBHDHMH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole?
The IUPAC name of 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole (CID 19425983) is 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole.
What is the SMILES notation for 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole?
The canonical SMILES for 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole is CN1Cc2ccc3c(c2C1)=NCN=3.
What is the InChIKey of 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole?
The InChIKey is VVFCTHLDBHDHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-13-4-7-2-3-9-10(8(7)5-13)12-6-11-9/h2-3H,4-6H2,1H3.
What are the key properties of 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole?
7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole has a molecular weight of 173.22 g/mol, XLogP of -0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6,8-dihydro-2H-pyrrolo[3,4-e]benzimidazole is sourced from PubChem (CID 19425983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).