C9H12O2 — CID 19426250
5-methyl-2,3,6,7-tetrahydro-1,4-benzodioxine (PubChem CID 19426250) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 5-methyl-2,3,6,7-tetrahydro-1,4-benzodioxine.
| Compound Name | 5-methyl-2,3,6,7-tetrahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 19426250 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 5-methyl-2,3,6,7-tetrahydro-1,4-benzodioxine |
| SMILES | CC1=C2OCCOC2=CCC1 |
| InChI | InChI=1S/C9H12O2/c1-7-3-2-4-8-9(7)11-6-5-10-8/h4H,2-3,5-6H2,1H3 |
| InChIKey | JDOUBQAXCVTXFE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |