About 1-methyl-3a,7a-dihydroindazole
1-methyl-3a,7a-dihydroindazole (PubChem CID 19426256) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1-methyl-3a,7a-dihydroindazole.
Molecular Properties
| Compound Name | 1-methyl-3a,7a-dihydroindazole |
| PubChem CID | 19426256 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1-methyl-3a,7a-dihydroindazole |
| SMILES | CN1N=CC2C=CC=CC21 |
| InChI | InChI=1S/C8H10N2/c1-10-8-5-3-2-4-7(8)6-9-10/h2-8H,1H3 |
| InChIKey | VQPWOMNLXJPCEF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3a,7a-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3a,7a-dihydroindazole?
The IUPAC name of 1-methyl-3a,7a-dihydroindazole (CID 19426256) is 1-methyl-3a,7a-dihydroindazole.
What is the SMILES notation for 1-methyl-3a,7a-dihydroindazole?
The canonical SMILES for 1-methyl-3a,7a-dihydroindazole is CN1N=CC2C=CC=CC21.
What is the InChIKey of 1-methyl-3a,7a-dihydroindazole?
The InChIKey is VQPWOMNLXJPCEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-10-8-5-3-2-4-7(8)6-9-10/h2-8H,1H3.
What are the key properties of 1-methyl-3a,7a-dihydroindazole?
1-methyl-3a,7a-dihydroindazole has a molecular weight of 134.18 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3a,7a-dihydroindazole is sourced from PubChem (CID 19426256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).