About 2-ethoxybenzoyl bromide
2-ethoxybenzoyl bromide (PubChem CID 19426336) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 2-ethoxybenzoyl bromide.
Molecular Properties
| Compound Name | 2-ethoxybenzoyl bromide |
| PubChem CID | 19426336 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 2-ethoxybenzoyl bromide |
| SMILES | CCOc1ccccc1C(=O)Br |
| InChI | InChI=1S/C9H9BrO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | BMDNZYMOKAGJSW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybenzoyl bromide?
The IUPAC name of 2-ethoxybenzoyl bromide (CID 19426336) is 2-ethoxybenzoyl bromide.
What is the SMILES notation for 2-ethoxybenzoyl bromide?
The canonical SMILES for 2-ethoxybenzoyl bromide is CCOc1ccccc1C(=O)Br.
What is the InChIKey of 2-ethoxybenzoyl bromide?
The InChIKey is BMDNZYMOKAGJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3.
What are the key properties of 2-ethoxybenzoyl bromide?
2-ethoxybenzoyl bromide has a molecular weight of 229.07 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzoyl bromide is sourced from PubChem (CID 19426336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).